C22H36O3Si — CID 100948215
tert-butyl-dimethyl-[[(1S,2R,3S,6R,7S,8R)-6-(oxan-2-yloxy)-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]oxy]silane (PubChem CID 100948215) has the molecular formula C22H36O3Si and a molecular weight of 376.61 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1S,2R,3S,6R,7S,8R)-6-(oxan-2-yloxy)-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1S,2R,3S,6R,7S,8R)-6-(oxan-2-yloxy)-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]oxy]silane |
|---|---|
| PubChem CID | 100948215 |
| Molecular Formula | C22H36O3Si |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | tert-butyl-dimethyl-[[(1S,2R,3S,6R,7S,8R)-6-(oxan-2-yloxy)-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]oxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@@H](OC2CCCCO2)[C@@H]2[C@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C22H36O3Si/c1-22(2,3)26(4,5)25-18-12-11-17(24-19-8-6-7-13-23-19)20-15-9-10-16(14-15)21(18)20/h9-12,15-21H,6-8,13-14H2,1-5H3/t15-,16+,17+,18-,19?,20+,21-/m0/s1 |
| InChIKey | XVPKNCBMVNTZAX-IZHJBMKXSA-N |
| XLogP | 5.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|