C19H36O4S2Si — CID 100948349
(3'aS,4'R,8'R,8'aR)-4'-[tert-butyl(dimethyl)silyl]oxy-2',2'-dimethylspiro[1,3-dithiane-2,6'-3a,4,5,7,8,8a-hexahydrocyclohepta[d][1,3]dioxole]-8'-ol (PubChem CID 100948349) has the molecular formula C19H36O4S2Si and a molecular weight of 420.71 g/mol. Its IUPAC name is (3'aS,4'R,8'R,8'aR)-4'-[tert-butyl(dimethyl)silyl]oxy-2',2'-dimethylspiro[1,3-dithiane-2,6'-3a,4,5,7,8,8a-hexahydrocyclohepta[d][1,3]dioxole]-8'-ol.
| Compound Name | (3'aS,4'R,8'R,8'aR)-4'-[tert-butyl(dimethyl)silyl]oxy-2',2'-dimethylspiro[1,3-dithiane-2,6'-3a,4,5,7,8,8a-hexahydrocyclohepta[d][1,3]dioxole]-8'-ol |
|---|---|
| PubChem CID | 100948349 |
| Molecular Formula | C19H36O4S2Si |
| Molecular Weight | 420.71 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | (3'aS,4'R,8'R,8'aR)-4'-[tert-butyl(dimethyl)silyl]oxy-2',2'-dimethylspiro[1,3-dithiane-2,6'-3a,4,5,7,8,8a-hexahydrocyclohepta[d][1,3]dioxole]-8'-ol |
| SMILES | CC1(C)O[C@H]2[C@H](O1)[C@H](O[Si](C)(C)C(C)(C)C)CC1(C[C@H]2O)SCCCS1 |
| InChI | InChI=1S/C19H36O4S2Si/c1-17(2,3)26(6,7)23-14-12-19(24-9-8-10-25-19)11-13(20)15-16(14)22-18(4,5)21-15/h13-16,20H,8-12H2,1-7H3/t13-,14-,15-,16-/m1/s1 |
| InChIKey | RNOSNUWJYYMYLW-KLHDSHLOSA-N |
| XLogP | 4.62 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.71 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|