C22H32O10 — CID 100948449
6,12-bis(dimethoxymethyl)-3,3,10,10-tetramethoxytricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione (PubChem CID 100948449) has the molecular formula C22H32O10 and a molecular weight of 456.49 g/mol. Its IUPAC name is 6,12-bis(dimethoxymethyl)-3,3,10,10-tetramethoxytricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione.
| Compound Name | 6,12-bis(dimethoxymethyl)-3,3,10,10-tetramethoxytricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione |
|---|---|
| PubChem CID | 100948449 |
| Molecular Formula | C22H32O10 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 6,12-bis(dimethoxymethyl)-3,3,10,10-tetramethoxytricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione |
| SMILES | COC(OC)C1=CC2C3C(C(C(OC)OC)=CC(=O)C3(OC)OC)C1C(=O)C2(OC)OC |
| InChI | InChI=1S/C22H32O10/c1-25-19(26-2)11-9-13-17-15(16(11)18(24)21(13,29-5)30-6)12(20(27-3)28-4)10-14(23)22(17,31-7)32-8/h9-10,13,15-17,19-20H,1-8H3 |
| InChIKey | RTMUCUXXTCTCQN-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|