About CID 100948564
CID 100948564 (PubChem CID 100948564) has the molecular formula C11H13Li2NO
and a molecular weight of 189.11 g/mol.
Molecular Properties
| Compound Name | CID 100948564 |
| PubChem CID | 100948564 |
| Molecular Formula | C11H13Li2NO |
| Molecular Weight | 189.11 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | — |
| SMILES | CC(C)(C)/C([O-])=N/c1[c]cccc1.[Li+].[Li] |
| InChI | InChI=1S/C11H14NO.2Li/c1-11(2,3)10(13)12-9-7-5-4-6-8-9;;/h4-7H,1-3H3,(H,12,13);;/q;;+1/p-1 |
| InChIKey | RLEMVJRCSUZZBW-UHFFFAOYSA-M |
| XLogP | -1.45 |
| TPSA | 35.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.11 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze CID 100948564 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 100948564?
The IUPAC name of CID 100948564 (CID 100948564) is not available.
What is the SMILES notation for CID 100948564?
The canonical SMILES for CID 100948564 is CC(C)(C)/C([O-])=N/c1[c]cccc1.[Li+].[Li].
What is the InChIKey of CID 100948564?
The InChIKey is RLEMVJRCSUZZBW-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H14NO.2Li/c1-11(2,3)10(13)12-9-7-5-4-6-8-9;;/h4-7H,1-3H3,(H,12,13);;/q;;+1/p-1.
What are the key properties of CID 100948564?
CID 100948564 has a molecular weight of 189.11 g/mol, XLogP of -1.45, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 100948564 is sourced from PubChem (CID 100948564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).