C19H30O6S — CID 100949000
(7S,9R,10S)-1-(benzenesulfonyl)-7,9,10-trihydroxy-2,2-dimethylundecan-3-one (PubChem CID 100949000) has the molecular formula C19H30O6S and a molecular weight of 386.51 g/mol. Its IUPAC name is (7S,9R,10S)-1-(benzenesulfonyl)-7,9,10-trihydroxy-2,2-dimethylundecan-3-one.
| Compound Name | (7S,9R,10S)-1-(benzenesulfonyl)-7,9,10-trihydroxy-2,2-dimethylundecan-3-one |
|---|---|
| PubChem CID | 100949000 |
| Molecular Formula | C19H30O6S |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | (7S,9R,10S)-1-(benzenesulfonyl)-7,9,10-trihydroxy-2,2-dimethylundecan-3-one |
| SMILES | C[C@H](O)[C@H](O)C[C@@H](O)CCCC(=O)C(C)(C)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H30O6S/c1-14(20)17(22)12-15(21)8-7-11-18(23)19(2,3)13-26(24,25)16-9-5-4-6-10-16/h4-6,9-10,14-15,17,20-22H,7-8,11-13H2,1-3H3/t14-,15-,17+/m0/s1 |
| InChIKey | ORTOKFVXFJQWLS-YQQAZPJKSA-N |
| XLogP | 1.72 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |