About 2-[(1S,3R)-2-tert-butyl-5-phenyl-2-adamantyl]propanedinitrile
2-[(1S,3R)-2-tert-butyl-5-phenyl-2-adamantyl]propanedinitrile (PubChem CID 100949111) has the molecular formula C23H28N2
and a molecular weight of 332.49 g/mol. Its IUPAC name is 2-[(1S,3R)-2-tert-butyl-5-phenyl-2-adamantyl]propanedinitrile.
Molecular Properties
| Compound Name | 2-[(1S,3R)-2-tert-butyl-5-phenyl-2-adamantyl]propanedinitrile |
| PubChem CID | 100949111 |
| Molecular Formula | C23H28N2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 2-[(1S,3R)-2-tert-butyl-5-phenyl-2-adamantyl]propanedinitrile |
| SMILES | CC(C)(C)C1(C(C#N)C#N)[C@@H]2CC3C[C@H]1CC(c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C23H28N2/c1-21(2,3)23(20(14-24)15-25)18-9-16-10-19(23)13-22(11-16,12-18)17-7-5-4-6-8-17/h4-8,16,18-20H,9-13H2,1-3H3/t16?,18-,19+,22?,23? |
| InChIKey | ULYQROVLKXBIOS-PMQSPZGISA-N |
| XLogP | 5.46 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(1S,3R)-2-tert-butyl-5-phenyl-2-adamantyl]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,3R)-2-tert-butyl-5-phenyl-2-adamantyl]propanedinitrile?
The IUPAC name of 2-[(1S,3R)-2-tert-butyl-5-phenyl-2-adamantyl]propanedinitrile (CID 100949111) is 2-[(1S,3R)-2-tert-butyl-5-phenyl-2-adamantyl]propanedinitrile.
What is the SMILES notation for 2-[(1S,3R)-2-tert-butyl-5-phenyl-2-adamantyl]propanedinitrile?
The canonical SMILES for 2-[(1S,3R)-2-tert-butyl-5-phenyl-2-adamantyl]propanedinitrile is CC(C)(C)C1(C(C#N)C#N)[C@@H]2CC3C[C@H]1CC(c1ccccc1)(C3)C2.
What is the InChIKey of 2-[(1S,3R)-2-tert-butyl-5-phenyl-2-adamantyl]propanedinitrile?
The InChIKey is ULYQROVLKXBIOS-PMQSPZGISA-N. The full InChI is InChI=1S/C23H28N2/c1-21(2,3)23(20(14-24)15-25)18-9-16-10-19(23)13-22(11-16,12-18)17-7-5-4-6-8-17/h4-8,16,18-20H,9-13H2,1-3H3/t16?,18-,19+,22?,23?.
What are the key properties of 2-[(1S,3R)-2-tert-butyl-5-phenyl-2-adamantyl]propanedinitrile?
2-[(1S,3R)-2-tert-butyl-5-phenyl-2-adamantyl]propanedinitrile has a molecular weight of 332.49 g/mol, XLogP of 5.46, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,3R)-2-tert-butyl-5-phenyl-2-adamantyl]propanedinitrile is sourced from PubChem (CID 100949111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).