C18H31NO5 — CID 100949293
dodecyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate (PubChem CID 100949293) has the molecular formula C18H31NO5 and a molecular weight of 341.45 g/mol. Its IUPAC name is dodecyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate.
| Compound Name | dodecyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate |
|---|---|
| PubChem CID | 100949293 |
| Molecular Formula | C18H31NO5 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | dodecyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate |
| SMILES | CCCCCCCCCCCCOC(=O)CCC1NC(=O)OC1=O |
| InChI | InChI=1S/C18H31NO5/c1-2-3-4-5-6-7-8-9-10-11-14-23-16(20)13-12-15-17(21)24-18(22)19-15/h15H,2-14H2,1H3,(H,19,22) |
| InChIKey | MSWFLEYNJAWAGE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|