About [(3R,5R)-2-methyl-5-propan-2-yl-3-prop-2-enylcyclohexen-1-yl]oxy-tri(propan-2-yl)silane
[(3R,5R)-2-methyl-5-propan-2-yl-3-prop-2-enylcyclohexen-1-yl]oxy-tri(propan-2-yl)silane (PubChem CID 100949310) has the molecular formula C22H42OSi
and a molecular weight of 350.66 g/mol. Its IUPAC name is [(3R,5R)-2-methyl-5-propan-2-yl-3-prop-2-enylcyclohexen-1-yl]oxy-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | [(3R,5R)-2-methyl-5-propan-2-yl-3-prop-2-enylcyclohexen-1-yl]oxy-tri(propan-2-yl)silane |
| PubChem CID | 100949310 |
| Molecular Formula | C22H42OSi |
| Molecular Weight | 350.66 g/mol |
| Exact Mass | 350.30 |
| IUPAC Name | [(3R,5R)-2-methyl-5-propan-2-yl-3-prop-2-enylcyclohexen-1-yl]oxy-tri(propan-2-yl)silane |
| SMILES | C=CC[C@@H]1C[C@@H](C(C)C)CC(O[Si](C(C)C)(C(C)C)C(C)C)=C1C |
| InChI | InChI=1S/C22H42OSi/c1-11-12-20-13-21(15(2)3)14-22(19(20)10)23-24(16(4)5,17(6)7)18(8)9/h11,15-18,20-21H,1,12-14H2,2-10H3/t20-,21-/m1/s1 |
| InChIKey | MMZFPKVCZHVIOS-NHCUHLMSSA-N |
| XLogP | 7.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.66 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3R,5R)-2-methyl-5-propan-2-yl-3-prop-2-enylcyclohexen-1-yl]oxy-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,5R)-2-methyl-5-propan-2-yl-3-prop-2-enylcyclohexen-1-yl]oxy-tri(propan-2-yl)silane?
The IUPAC name of [(3R,5R)-2-methyl-5-propan-2-yl-3-prop-2-enylcyclohexen-1-yl]oxy-tri(propan-2-yl)silane (CID 100949310) is [(3R,5R)-2-methyl-5-propan-2-yl-3-prop-2-enylcyclohexen-1-yl]oxy-tri(propan-2-yl)silane.
What is the SMILES notation for [(3R,5R)-2-methyl-5-propan-2-yl-3-prop-2-enylcyclohexen-1-yl]oxy-tri(propan-2-yl)silane?
The canonical SMILES for [(3R,5R)-2-methyl-5-propan-2-yl-3-prop-2-enylcyclohexen-1-yl]oxy-tri(propan-2-yl)silane is C=CC[C@@H]1C[C@@H](C(C)C)CC(O[Si](C(C)C)(C(C)C)C(C)C)=C1C.
What is the InChIKey of [(3R,5R)-2-methyl-5-propan-2-yl-3-prop-2-enylcyclohexen-1-yl]oxy-tri(propan-2-yl)silane?
The InChIKey is MMZFPKVCZHVIOS-NHCUHLMSSA-N. The full InChI is InChI=1S/C22H42OSi/c1-11-12-20-13-21(15(2)3)14-22(19(20)10)23-24(16(4)5,17(6)7)18(8)9/h11,15-18,20-21H,1,12-14H2,2-10H3/t20-,21-/m1/s1.
What are the key properties of [(3R,5R)-2-methyl-5-propan-2-yl-3-prop-2-enylcyclohexen-1-yl]oxy-tri(propan-2-yl)silane?
[(3R,5R)-2-methyl-5-propan-2-yl-3-prop-2-enylcyclohexen-1-yl]oxy-tri(propan-2-yl)silane has a molecular weight of 350.66 g/mol, XLogP of 7.71, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,5R)-2-methyl-5-propan-2-yl-3-prop-2-enylcyclohexen-1-yl]oxy-tri(propan-2-yl)silane is sourced from PubChem (CID 100949310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).