C24H40O3Si — CID 100949577
methyl (4aS,4bR,8aR,10aS)-2-[tert-butyl(dimethyl)silyl]oxy-4a,7-dimethyl-3,4,4b,5,8,9,10,10a-octahydrophenanthrene-8a-carboxylate (PubChem CID 100949577) has the molecular formula C24H40O3Si and a molecular weight of 404.67 g/mol. Its IUPAC name is methyl (4aS,4bR,8aR,10aS)-2-[tert-butyl(dimethyl)silyl]oxy-4a,7-dimethyl-3,4,4b,5,8,9,10,10a-octahydrophenanthrene-8a-carboxylate.
| Compound Name | methyl (4aS,4bR,8aR,10aS)-2-[tert-butyl(dimethyl)silyl]oxy-4a,7-dimethyl-3,4,4b,5,8,9,10,10a-octahydrophenanthrene-8a-carboxylate |
|---|---|
| PubChem CID | 100949577 |
| Molecular Formula | C24H40O3Si |
| Molecular Weight | 404.67 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | methyl (4aS,4bR,8aR,10aS)-2-[tert-butyl(dimethyl)silyl]oxy-4a,7-dimethyl-3,4,4b,5,8,9,10,10a-octahydrophenanthrene-8a-carboxylate |
| SMILES | COC(=O)[C@@]12CC[C@H]3C=C(O[Si](C)(C)C(C)(C)C)CC[C@]3(C)[C@H]1CC=C(C)C2 |
| InChI | InChI=1S/C24H40O3Si/c1-17-9-10-20-23(5)13-12-19(27-28(7,8)22(2,3)4)15-18(23)11-14-24(20,16-17)21(25)26-6/h9,15,18,20H,10-14,16H2,1-8H3/t18-,20+,23-,24+/m0/s1 |
| InChIKey | ROQUTIWKIKYXJG-GONLTWLXSA-N |
| XLogP | 6.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.67 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|