C11H16O6 — CID 100949799
[(1S,4S,5S,6S)-6-acetyloxy-4,5-dihydroxy-5-methylcyclohex-2-en-1-yl] acetate (PubChem CID 100949799) has the molecular formula C11H16O6 and a molecular weight of 244.24 g/mol. Its IUPAC name is [(1S,4S,5S,6S)-6-acetyloxy-4,5-dihydroxy-5-methylcyclohex-2-en-1-yl] acetate.
| Compound Name | [(1S,4S,5S,6S)-6-acetyloxy-4,5-dihydroxy-5-methylcyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 100949799 |
| Molecular Formula | C11H16O6 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | [(1S,4S,5S,6S)-6-acetyloxy-4,5-dihydroxy-5-methylcyclohex-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C[C@H](O)[C@](C)(O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C11H16O6/c1-6(12)16-8-4-5-9(14)11(3,15)10(8)17-7(2)13/h4-5,8-10,14-15H,1-3H3/t8-,9-,10-,11-/m0/s1 |
| InChIKey | WOAWXSWQCBUEBC-NAKRPEOUSA-N |
| XLogP | -0.47 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|