C24H28O8 — CID 10094991
2-[(4bS)-3-acetyloxy-9-hydroxy-4b,8,8-trimethyl-1,4,10-trioxo-6,7-dihydro-5H-phenanthren-2-yl]propyl acetate (PubChem CID 10094991) has the molecular formula C24H28O8 and a molecular weight of 444.48 g/mol. Its IUPAC name is 2-[(4bS)-3-acetyloxy-9-hydroxy-4b,8,8-trimethyl-1,4,10-trioxo-6,7-dihydro-5H-phenanthren-2-yl]propyl acetate.
| Compound Name | 2-[(4bS)-3-acetyloxy-9-hydroxy-4b,8,8-trimethyl-1,4,10-trioxo-6,7-dihydro-5H-phenanthren-2-yl]propyl acetate |
|---|---|
| PubChem CID | 10094991 |
| Molecular Formula | C24H28O8 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 2-[(4bS)-3-acetyloxy-9-hydroxy-4b,8,8-trimethyl-1,4,10-trioxo-6,7-dihydro-5H-phenanthren-2-yl]propyl acetate |
| SMILES | CC(=O)OCC(C)C1=C(OC(C)=O)C(=O)C2=C(C(=O)C(O)=C3C(C)(C)CCC[C@]23C)C1=O |
| InChI | InChI=1S/C24H28O8/c1-11(10-31-12(2)25)14-17(27)15-16(19(29)21(14)32-13(3)26)24(6)9-7-8-23(4,5)22(24)20(30)18(15)28/h11,30H,7-10H2,1-6H3/t11?,24-/m1/s1 |
| InChIKey | UUVKKHSAZOSIOH-RQEJEBGASA-N |
| XLogP | 3.06 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|