C23H41O6P — CID 10095000
[3-hydroxy-2-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoxy]propyl] dihydrogen phosphate (PubChem CID 10095000) has the molecular formula C23H41O6P and a molecular weight of 444.55 g/mol. Its IUPAC name is [3-hydroxy-2-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoxy]propyl] dihydrogen phosphate.
| Compound Name | [3-hydroxy-2-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoxy]propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 10095000 |
| Molecular Formula | C23H41O6P |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | [3-hydroxy-2-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoxy]propyl] dihydrogen phosphate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCOC(CO)COP(=O)(O)O |
| InChI | InChI=1S/C23H41O6P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-28-23(21-24)22-29-30(25,26)27/h6-7,9-10,12-13,15-16,23-24H,2-5,8,11,14,17-22H2,1H3,(H2,25,26,27)/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | MZEGZZYBVMOFSK-DOFZRALJSA-N |
| XLogP | 5.62 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|