C23H44O6Si — CID 10095013
3-[(4R,7S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-2,3,4,7,8,8a-hexahydro-1H-naphthalen-4a-yl]propane-1,2-diol (PubChem CID 10095013) has the molecular formula C23H44O6Si and a molecular weight of 444.69 g/mol. Its IUPAC name is 3-[(4R,7S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-2,3,4,7,8,8a-hexahydro-1H-naphthalen-4a-yl]propane-1,2-diol.
| Compound Name | 3-[(4R,7S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-2,3,4,7,8,8a-hexahydro-1H-naphthalen-4a-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 10095013 |
| Molecular Formula | C23H44O6Si |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | 3-[(4R,7S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-2,3,4,7,8,8a-hexahydro-1H-naphthalen-4a-yl]propane-1,2-diol |
| SMILES | COCCOCO[C@@H]1CCC[C@@H]2C[C@H](O[Si](C)(C)C(C)(C)C)C=CC21CC(O)CO |
| InChI | InChI=1S/C23H44O6Si/c1-22(2,3)30(5,6)29-20-10-11-23(15-19(25)16-24)18(14-20)8-7-9-21(23)28-17-27-13-12-26-4/h10-11,18-21,24-25H,7-9,12-17H2,1-6H3/t18-,19?,20-,21-,23?/m1/s1 |
| InChIKey | XWQZANMCILAIFK-OEMITHLSSA-N |
| XLogP | 3.87 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|