C21H20FN3O5S — CID 10095037
6-fluoro-3-(8-hydroxy-1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)-1-(3-methylbutyl)quinoline-2,4-dione (PubChem CID 10095037) has the molecular formula C21H20FN3O5S and a molecular weight of 445.47 g/mol. Its IUPAC name is 6-fluoro-3-(8-hydroxy-1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)-1-(3-methylbutyl)quinoline-2,4-dione.
| Compound Name | 6-fluoro-3-(8-hydroxy-1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)-1-(3-methylbutyl)quinoline-2,4-dione |
|---|---|
| PubChem CID | 10095037 |
| Molecular Formula | C21H20FN3O5S |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 6-fluoro-3-(8-hydroxy-1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)-1-(3-methylbutyl)quinoline-2,4-dione |
| SMILES | CC(C)CCN1C(=O)C(C2=NS(=O)(=O)c3c(O)cccc3N2)C(=O)c2cc(F)ccc21 |
| InChI | InChI=1S/C21H20FN3O5S/c1-11(2)8-9-25-15-7-6-12(22)10-13(15)18(27)17(21(25)28)20-23-14-4-3-5-16(26)19(14)31(29,30)24-20/h3-7,10-11,17,26H,8-9H2,1-2H3,(H,23,24) |
| InChIKey | ORMYBQLVDOOICA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|