C6H11O7P — CID 100950413
[(1R,5R,7R,8R)-3-hydroxy-8-methoxy-3-oxo-2,4,6-trioxa-3λ5-phosphabicyclo[3.2.1]octan-7-yl]methanol (PubChem CID 100950413) has the molecular formula C6H11O7P and a molecular weight of 226.12 g/mol. Its IUPAC name is [(1R,5R,7R,8R)-3-hydroxy-8-methoxy-3-oxo-2,4,6-trioxa-3λ5-phosphabicyclo[3.2.1]octan-7-yl]methanol.
| Compound Name | [(1R,5R,7R,8R)-3-hydroxy-8-methoxy-3-oxo-2,4,6-trioxa-3λ5-phosphabicyclo[3.2.1]octan-7-yl]methanol |
|---|---|
| PubChem CID | 100950413 |
| Molecular Formula | C6H11O7P |
| Molecular Weight | 226.12 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | [(1R,5R,7R,8R)-3-hydroxy-8-methoxy-3-oxo-2,4,6-trioxa-3λ5-phosphabicyclo[3.2.1]octan-7-yl]methanol |
| SMILES | CO[C@H]1[C@@H]2O[C@H](CO)[C@H]1OP(=O)(O)O2 |
| InChI | InChI=1S/C6H11O7P/c1-10-5-4-3(2-7)11-6(5)13-14(8,9)12-4/h3-7H,2H2,1H3,(H,8,9)/t3-,4-,5-,6-/m1/s1 |
| InChIKey | VDNWSDZIRWMDCC-KVTDHHQDSA-N |
| XLogP | -0.77 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.12 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|