About 1-chloro-8-iodotricyclo[5.2.0.02,5]nonane
1-chloro-8-iodotricyclo[5.2.0.02,5]nonane (PubChem CID 100950476) has the molecular formula C9H12ClI
and a molecular weight of 282.55 g/mol. Its IUPAC name is 1-chloro-8-iodotricyclo[5.2.0.02,5]nonane.
Molecular Properties
| Compound Name | 1-chloro-8-iodotricyclo[5.2.0.02,5]nonane |
| PubChem CID | 100950476 |
| Molecular Formula | C9H12ClI |
| Molecular Weight | 282.55 g/mol |
| Exact Mass | 281.97 |
| IUPAC Name | 1-chloro-8-iodotricyclo[5.2.0.02,5]nonane |
| SMILES | ClC12CC(I)C1CC1CCC12 |
| InChI | InChI=1S/C9H12ClI/c10-9-4-8(11)7(9)3-5-1-2-6(5)9/h5-8H,1-4H2 |
| InChIKey | DHRFSEUSRMQRSZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-8-iodotricyclo[5.2.0.02,5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-8-iodotricyclo[5.2.0.02,5]nonane?
The IUPAC name of 1-chloro-8-iodotricyclo[5.2.0.02,5]nonane (CID 100950476) is 1-chloro-8-iodotricyclo[5.2.0.02,5]nonane.
What is the SMILES notation for 1-chloro-8-iodotricyclo[5.2.0.02,5]nonane?
The canonical SMILES for 1-chloro-8-iodotricyclo[5.2.0.02,5]nonane is ClC12CC(I)C1CC1CCC12.
What is the InChIKey of 1-chloro-8-iodotricyclo[5.2.0.02,5]nonane?
The InChIKey is DHRFSEUSRMQRSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12ClI/c10-9-4-8(11)7(9)3-5-1-2-6(5)9/h5-8H,1-4H2.
What are the key properties of 1-chloro-8-iodotricyclo[5.2.0.02,5]nonane?
1-chloro-8-iodotricyclo[5.2.0.02,5]nonane has a molecular weight of 282.55 g/mol, XLogP of 3.22, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-8-iodotricyclo[5.2.0.02,5]nonane is sourced from PubChem (CID 100950476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).