C26H31N5O2 — CID 10095052
6-(4-ethoxy-2-methoxyphenyl)-1,5,7-trimethyl-N-(3-pyridin-3-ylpropyl)pyrrolo[3,4-d]pyridazin-4-amine (PubChem CID 10095052) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is 6-(4-ethoxy-2-methoxyphenyl)-1,5,7-trimethyl-N-(3-pyridin-3-ylpropyl)pyrrolo[3,4-d]pyridazin-4-amine.
| Compound Name | 6-(4-ethoxy-2-methoxyphenyl)-1,5,7-trimethyl-N-(3-pyridin-3-ylpropyl)pyrrolo[3,4-d]pyridazin-4-amine |
|---|---|
| PubChem CID | 10095052 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 6-(4-ethoxy-2-methoxyphenyl)-1,5,7-trimethyl-N-(3-pyridin-3-ylpropyl)pyrrolo[3,4-d]pyridazin-4-amine |
| SMILES | CCOc1ccc(-n2c(C)c3c(C)nnc(NCCCc4cccnc4)c3c2C)c(OC)c1 |
| InChI | InChI=1S/C26H31N5O2/c1-6-33-21-11-12-22(23(15-21)32-5)31-18(3)24-17(2)29-30-26(25(24)19(31)4)28-14-8-10-20-9-7-13-27-16-20/h7,9,11-13,15-16H,6,8,10,14H2,1-5H3,(H,28,30) |
| InChIKey | JMDVUOALTHREAM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|