C19H30O4SSi — CID 100950606
(2R,3S,4S)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethylcyclopentan-1-one (PubChem CID 100950606) has the molecular formula C19H30O4SSi and a molecular weight of 382.60 g/mol. Its IUPAC name is (2R,3S,4S)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethylcyclopentan-1-one.
| Compound Name | (2R,3S,4S)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethylcyclopentan-1-one |
|---|---|
| PubChem CID | 100950606 |
| Molecular Formula | C19H30O4SSi |
| Molecular Weight | 382.60 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | (2R,3S,4S)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethylcyclopentan-1-one |
| SMILES | CC[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H30O4SSi/c1-7-15-17(23-25(5,6)19(2,3)4)13-16(20)18(15)24(21,22)14-11-9-8-10-12-14/h8-12,15,17-18H,7,13H2,1-6H3/t15-,17-,18+/m0/s1 |
| InChIKey | JWPJWMMYRTUMAZ-RYQLBKOJSA-N |
| XLogP | 4.22 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.60 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|