C21H34O4SSi — CID 100950607
(2R,3S,4S)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-(2-methylpropyl)cyclopentan-1-one (PubChem CID 100950607) has the molecular formula C21H34O4SSi and a molecular weight of 410.65 g/mol. Its IUPAC name is (2R,3S,4S)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-(2-methylpropyl)cyclopentan-1-one.
| Compound Name | (2R,3S,4S)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-(2-methylpropyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 100950607 |
| Molecular Formula | C21H34O4SSi |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | (2R,3S,4S)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-(2-methylpropyl)cyclopentan-1-one |
| SMILES | CC(C)C[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H34O4SSi/c1-15(2)13-17-19(25-27(6,7)21(3,4)5)14-18(22)20(17)26(23,24)16-11-9-8-10-12-16/h8-12,15,17,19-20H,13-14H2,1-7H3/t17-,19-,20+/m0/s1 |
| InChIKey | LJQASQGOVVNEDH-YSIASYRMSA-N |
| XLogP | 4.85 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|