C11H11FN2S — CID 100951007
(3R)-3-(fluoromethyl)-7-isothiocyanato-1,2,3,4-tetrahydroisoquinoline (PubChem CID 100951007) has the molecular formula C11H11FN2S and a molecular weight of 222.29 g/mol. Its IUPAC name is (3R)-3-(fluoromethyl)-7-isothiocyanato-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (3R)-3-(fluoromethyl)-7-isothiocyanato-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 100951007 |
| Molecular Formula | C11H11FN2S |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | (3R)-3-(fluoromethyl)-7-isothiocyanato-1,2,3,4-tetrahydroisoquinoline |
| SMILES | FC[C@H]1Cc2ccc(N=C=S)cc2CN1 |
| InChI | InChI=1S/C11H11FN2S/c12-5-11-3-8-1-2-10(14-7-15)4-9(8)6-13-11/h1-2,4,11,13H,3,5-6H2/t11-/m1/s1 |
| InChIKey | VKQGFYVCKLGQHW-LLVKDONJSA-N |
| XLogP | 2.40 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|