C21H13F6N3O2 — CID 100951475
2,2,2-trifluoro-1-[2-(4-methoxyphenyl)-4-(trifluoromethyl)pyrido[3,2-h]quinazolin-6-yl]ethanol (PubChem CID 100951475) has the molecular formula C21H13F6N3O2 and a molecular weight of 453.34 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[2-(4-methoxyphenyl)-4-(trifluoromethyl)pyrido[3,2-h]quinazolin-6-yl]ethanol.
| Compound Name | 2,2,2-trifluoro-1-[2-(4-methoxyphenyl)-4-(trifluoromethyl)pyrido[3,2-h]quinazolin-6-yl]ethanol |
|---|---|
| PubChem CID | 100951475 |
| Molecular Formula | C21H13F6N3O2 |
| Molecular Weight | 453.34 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 2,2,2-trifluoro-1-[2-(4-methoxyphenyl)-4-(trifluoromethyl)pyrido[3,2-h]quinazolin-6-yl]ethanol |
| SMILES | COc1ccc(-c2nc(C(F)(F)F)c3cc(C(O)C(F)(F)F)c4cccnc4c3n2)cc1 |
| InChI | InChI=1S/C21H13F6N3O2/c1-32-11-6-4-10(5-7-11)19-29-16-14(17(30-19)20(22,23)24)9-13(18(31)21(25,26)27)12-3-2-8-28-15(12)16/h2-9,18,31H,1H3 |
| InChIKey | YGIPWKYUQOWIGZ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.34 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|