About N-[5-bromo-6,7-difluoro-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide
N-[5-bromo-6,7-difluoro-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide (PubChem CID 10095181) has the molecular formula C17H24BrF2N3O2Si
and a molecular weight of 448.38 g/mol. Its IUPAC name is N-[5-bromo-6,7-difluoro-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide.
Molecular Properties
| Compound Name | N-[5-bromo-6,7-difluoro-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide |
| PubChem CID | 10095181 |
| Molecular Formula | C17H24BrF2N3O2Si |
| Molecular Weight | 448.38 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | N-[5-bromo-6,7-difluoro-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide |
| SMILES | CCCC(=O)Nc1nn(COCC[Si](C)(C)C)c2c(F)c(F)c(Br)cc12 |
| InChI | InChI=1S/C17H24BrF2N3O2Si/c1-5-6-13(24)21-17-11-9-12(18)14(19)15(20)16(11)23(22-17)10-25-7-8-26(2,3)4/h9H,5-8,10H2,1-4H3,(H,21,22,24) |
| InChIKey | QYUOATCXTVZREV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.38 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-[5-bromo-6,7-difluoro-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-bromo-6,7-difluoro-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide?
The IUPAC name of N-[5-bromo-6,7-difluoro-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide (CID 10095181) is N-[5-bromo-6,7-difluoro-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide.
What is the SMILES notation for N-[5-bromo-6,7-difluoro-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide?
The canonical SMILES for N-[5-bromo-6,7-difluoro-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide is CCCC(=O)Nc1nn(COCC[Si](C)(C)C)c2c(F)c(F)c(Br)cc12.
What is the InChIKey of N-[5-bromo-6,7-difluoro-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide?
The InChIKey is QYUOATCXTVZREV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24BrF2N3O2Si/c1-5-6-13(24)21-17-11-9-12(18)14(19)15(20)16(11)23(22-17)10-25-7-8-26(2,3)4/h9H,5-8,10H2,1-4H3,(H,21,22,24).
What are the key properties of N-[5-bromo-6,7-difluoro-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide?
N-[5-bromo-6,7-difluoro-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide has a molecular weight of 448.38 g/mol, XLogP of 5.13, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-bromo-6,7-difluoro-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide is sourced from PubChem (CID 10095181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).