About (4E)-8-methyl-4-prop-2-enylnona-4,8-dienal
(4E)-8-methyl-4-prop-2-enylnona-4,8-dienal (PubChem CID 100952255) has the molecular formula C13H20O
and a molecular weight of 192.30 g/mol. Its IUPAC name is (4E)-8-methyl-4-prop-2-enylnona-4,8-dienal.
Molecular Properties
| Compound Name | (4E)-8-methyl-4-prop-2-enylnona-4,8-dienal |
| PubChem CID | 100952255 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (4E)-8-methyl-4-prop-2-enylnona-4,8-dienal |
| SMILES | C=CC/C(=C/CCC(=C)C)CCC=O |
| InChI | InChI=1S/C13H20O/c1-4-7-13(10-6-11-14)9-5-8-12(2)3/h4,9,11H,1-2,5-8,10H2,3H3/b13-9- |
| InChIKey | AVIQDFNWXQCKLA-LCYFTJDESA-N |
| XLogP | 3.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-8-methyl-4-prop-2-enylnona-4,8-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-8-methyl-4-prop-2-enylnona-4,8-dienal?
The IUPAC name of (4E)-8-methyl-4-prop-2-enylnona-4,8-dienal (CID 100952255) is (4E)-8-methyl-4-prop-2-enylnona-4,8-dienal.
What is the SMILES notation for (4E)-8-methyl-4-prop-2-enylnona-4,8-dienal?
The canonical SMILES for (4E)-8-methyl-4-prop-2-enylnona-4,8-dienal is C=CC/C(=C/CCC(=C)C)CCC=O.
What is the InChIKey of (4E)-8-methyl-4-prop-2-enylnona-4,8-dienal?
The InChIKey is AVIQDFNWXQCKLA-LCYFTJDESA-N. The full InChI is InChI=1S/C13H20O/c1-4-7-13(10-6-11-14)9-5-8-12(2)3/h4,9,11H,1-2,5-8,10H2,3H3/b13-9-.
What are the key properties of (4E)-8-methyl-4-prop-2-enylnona-4,8-dienal?
(4E)-8-methyl-4-prop-2-enylnona-4,8-dienal has a molecular weight of 192.30 g/mol, XLogP of 3.82, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-8-methyl-4-prop-2-enylnona-4,8-dienal is sourced from PubChem (CID 100952255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).