C42H63ClN6O6S — CID 100952270
2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[3-[2-(7-chloro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)propylsulfamoyl]-4-(2-ethoxyethoxy)phenyl]octanamide (PubChem CID 100952270) has the molecular formula C42H63ClN6O6S and a molecular weight of 815.52 g/mol. Its IUPAC name is 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[3-[2-(7-chloro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)propylsulfamoyl]-4-(2-ethoxyethoxy)phenyl]octanamide.
| Compound Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[3-[2-(7-chloro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)propylsulfamoyl]-4-(2-ethoxyethoxy)phenyl]octanamide |
|---|---|
| PubChem CID | 100952270 |
| Molecular Formula | C42H63ClN6O6S |
| Molecular Weight | 815.52 g/mol |
| Exact Mass | 814.42 |
| IUPAC Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[3-[2-(7-chloro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)propylsulfamoyl]-4-(2-ethoxyethoxy)phenyl]octanamide |
| SMILES | CCCCCCC(Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC)C(=O)Nc1ccc(OCCOCC)c(S(=O)(=O)NCC(C)c2nc3c(Cl)c(C)[nH]n3n2)c1 |
| InChI | InChI=1S/C42H63ClN6O6S/c1-11-15-16-17-18-35(55-33-21-19-30(41(7,8)12-2)25-32(33)42(9,10)13-3)40(50)45-31-20-22-34(54-24-23-53-14-4)36(26-31)56(51,52)44-27-28(5)38-46-39-37(43)29(6)47-49(39)48-38/h19-22,25-26,28,35,44,47H,11-18,23-24,27H2,1-10H3,(H,45,50) |
| InChIKey | VJXHSSCLVCTXDO-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 148.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.52 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|