C19H26F3N3O4S — CID 10095238
N-hydroxy-1-[4-[5-(3,3,3-trifluoropropyl)-2-pyridinyl]piperidin-1-yl]sulfonylcyclopentane-1-carboxamide (PubChem CID 10095238) has the molecular formula C19H26F3N3O4S and a molecular weight of 449.50 g/mol. Its IUPAC name is N-hydroxy-1-[4-[5-(3,3,3-trifluoropropyl)-2-pyridinyl]piperidin-1-yl]sulfonylcyclopentane-1-carboxamide.
| Compound Name | N-hydroxy-1-[4-[5-(3,3,3-trifluoropropyl)-2-pyridinyl]piperidin-1-yl]sulfonylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 10095238 |
| Molecular Formula | C19H26F3N3O4S |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | N-hydroxy-1-[4-[5-(3,3,3-trifluoropropyl)-2-pyridinyl]piperidin-1-yl]sulfonylcyclopentane-1-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)N2CCC(c3ccc(CCC(F)(F)F)cn3)CC2)CCCC1 |
| InChI | InChI=1S/C19H26F3N3O4S/c20-19(21,22)10-5-14-3-4-16(23-13-14)15-6-11-25(12-7-15)30(28,29)18(17(26)24-27)8-1-2-9-18/h3-4,13,15,27H,1-2,5-12H2,(H,24,26) |
| InChIKey | PUTYDUWMPRYFAH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|