About 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane
1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane (PubChem CID 100952466) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane.
Molecular Properties
| Compound Name | 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane |
| PubChem CID | 100952466 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane |
| SMILES | CC(C)C1OC12CCC1(CC2)OCCO1 |
| InChI | InChI=1S/C12H20O3/c1-9(2)10-11(15-10)3-5-12(6-4-11)13-7-8-14-12/h9-10H,3-8H2,1-2H3 |
| InChIKey | WWUBQTFKYDFECD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane?
The IUPAC name of 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane (CID 100952466) is 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane.
What is the SMILES notation for 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane?
The canonical SMILES for 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane is CC(C)C1OC12CCC1(CC2)OCCO1.
What is the InChIKey of 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane?
The InChIKey is WWUBQTFKYDFECD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3/c1-9(2)10-11(15-10)3-5-12(6-4-11)13-7-8-14-12/h9-10H,3-8H2,1-2H3.
What are the key properties of 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane?
1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane has a molecular weight of 212.29 g/mol, XLogP of 2.10, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane is sourced from PubChem (CID 100952466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).