About ethyl 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane-1-carboxylate
ethyl 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane-1-carboxylate (PubChem CID 100952467) has the molecular formula C15H24O5
and a molecular weight of 284.35 g/mol. Its IUPAC name is ethyl 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane-1-carboxylate |
| PubChem CID | 100952467 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | ethyl 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane-1-carboxylate |
| SMILES | CCOC(=O)C1(C(C)C)OC12CCC1(CC2)OCCO1 |
| InChI | InChI=1S/C15H24O5/c1-4-17-12(16)15(11(2)3)13(20-15)5-7-14(8-6-13)18-9-10-19-14/h11H,4-10H2,1-3H3 |
| InChIKey | RDWKVCDTPXVMQX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane-1-carboxylate?
The IUPAC name of ethyl 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane-1-carboxylate (CID 100952467) is ethyl 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane-1-carboxylate.
What is the SMILES notation for ethyl 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane-1-carboxylate?
The canonical SMILES for ethyl 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane-1-carboxylate is CCOC(=O)C1(C(C)C)OC12CCC1(CC2)OCCO1.
What is the InChIKey of ethyl 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane-1-carboxylate?
The InChIKey is RDWKVCDTPXVMQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O5/c1-4-17-12(16)15(11(2)3)13(20-15)5-7-14(8-6-13)18-9-10-19-14/h11H,4-10H2,1-3H3.
What are the key properties of ethyl 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane-1-carboxylate?
ethyl 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane-1-carboxylate has a molecular weight of 284.35 g/mol, XLogP of 2.03, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-propan-2-yl-2,7,10-trioxadispiro[2.2.46.23]dodecane-1-carboxylate is sourced from PubChem (CID 100952467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).