C24H24O2 — CID 100952791
1-[(5R,7R,7aR)-7-benzoyl-4-phenyl-2,3,5,6,7,7a-hexahydro-1H-inden-5-yl]ethanone (PubChem CID 100952791) has the molecular formula C24H24O2 and a molecular weight of 344.45 g/mol. Its IUPAC name is 1-[(5R,7R,7aR)-7-benzoyl-4-phenyl-2,3,5,6,7,7a-hexahydro-1H-inden-5-yl]ethanone.
| Compound Name | 1-[(5R,7R,7aR)-7-benzoyl-4-phenyl-2,3,5,6,7,7a-hexahydro-1H-inden-5-yl]ethanone |
|---|---|
| PubChem CID | 100952791 |
| Molecular Formula | C24H24O2 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 1-[(5R,7R,7aR)-7-benzoyl-4-phenyl-2,3,5,6,7,7a-hexahydro-1H-inden-5-yl]ethanone |
| SMILES | CC(=O)[C@@H]1C[C@@H](C(=O)c2ccccc2)[C@H]2CCCC2=C1c1ccccc1 |
| InChI | InChI=1S/C24H24O2/c1-16(25)21-15-22(24(26)18-11-6-3-7-12-18)19-13-8-14-20(19)23(21)17-9-4-2-5-10-17/h2-7,9-12,19,21-22H,8,13-15H2,1H3/t19-,21-,22+/m0/s1 |
| InChIKey | PLHBXGJNIPQWTP-ILWGZMRPSA-N |
| XLogP | 5.35 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |