C19H22Cl2N2O4 — CID 100953055
(N,N'-ditert-butylcarbamimidoyl) 6,8-dichloro-2-oxochromene-3-carboxylate (PubChem CID 100953055) has the molecular formula C19H22Cl2N2O4 and a molecular weight of 413.30 g/mol. Its IUPAC name is (N,N'-ditert-butylcarbamimidoyl) 6,8-dichloro-2-oxochromene-3-carboxylate.
| Compound Name | (N,N'-ditert-butylcarbamimidoyl) 6,8-dichloro-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 100953055 |
| Molecular Formula | C19H22Cl2N2O4 |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | (N,N'-ditert-butylcarbamimidoyl) 6,8-dichloro-2-oxochromene-3-carboxylate |
| SMILES | CC(C)(C)/N=C(\NC(C)(C)C)OC(=O)c1cc2cc(Cl)cc(Cl)c2oc1=O |
| InChI | InChI=1S/C19H22Cl2N2O4/c1-18(2,3)22-17(23-19(4,5)6)27-16(25)12-8-10-7-11(20)9-13(21)14(10)26-15(12)24/h7-9H,1-6H3,(H,22,23) |
| InChIKey | VNRSHJXFKVILSM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|