C19H23BrN2O4 — CID 100953059
6-bromo-N-tert-butyl-N-(tert-butylcarbamoyl)-2-oxochromene-3-carboxamide (PubChem CID 100953059) has the molecular formula C19H23BrN2O4 and a molecular weight of 423.31 g/mol. Its IUPAC name is 6-bromo-N-tert-butyl-N-(tert-butylcarbamoyl)-2-oxochromene-3-carboxamide.
| Compound Name | 6-bromo-N-tert-butyl-N-(tert-butylcarbamoyl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 100953059 |
| Molecular Formula | C19H23BrN2O4 |
| Molecular Weight | 423.31 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 6-bromo-N-tert-butyl-N-(tert-butylcarbamoyl)-2-oxochromene-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)N(C(=O)c1cc2cc(Br)ccc2oc1=O)C(C)(C)C |
| InChI | InChI=1S/C19H23BrN2O4/c1-18(2,3)21-17(25)22(19(4,5)6)15(23)13-10-11-9-12(20)7-8-14(11)26-16(13)24/h7-10H,1-6H3,(H,21,25) |
| InChIKey | DAEPSORYZBBRFN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.31 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|