C24H28N2O8 — CID 100953363
ethyl (4S,5R)-2-[(2S,3R)-1-ethoxy-3-hydroxy-3-(4-nitrophenyl)-1-oxopropan-2-yl]-4-methyl-5-phenyl-1,3-oxazolidine-3-carboxylate (PubChem CID 100953363) has the molecular formula C24H28N2O8 and a molecular weight of 472.49 g/mol. Its IUPAC name is ethyl (4S,5R)-2-[(2S,3R)-1-ethoxy-3-hydroxy-3-(4-nitrophenyl)-1-oxopropan-2-yl]-4-methyl-5-phenyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | ethyl (4S,5R)-2-[(2S,3R)-1-ethoxy-3-hydroxy-3-(4-nitrophenyl)-1-oxopropan-2-yl]-4-methyl-5-phenyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 100953363 |
| Molecular Formula | C24H28N2O8 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | ethyl (4S,5R)-2-[(2S,3R)-1-ethoxy-3-hydroxy-3-(4-nitrophenyl)-1-oxopropan-2-yl]-4-methyl-5-phenyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H](C1O[C@H](c2ccccc2)[C@H](C)N1C(=O)OCC)[C@@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H28N2O8/c1-4-32-23(28)19(20(27)16-11-13-18(14-12-16)26(30)31)22-25(24(29)33-5-2)15(3)21(34-22)17-9-7-6-8-10-17/h6-15,19-22,27H,4-5H2,1-3H3/t15-,19-,20-,21-,22?/m0/s1 |
| InChIKey | KOTLNZFGLMRKGF-FGVUGOLVSA-N |
| XLogP | 3.75 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|