C20H36O4Si — CID 100953379
(2R,3S)-2-(cyclopenten-1-yl)-2-hydroxy-3-[tri(propan-2-yl)silyloxymethyl]pent-4-enoic acid (PubChem CID 100953379) has the molecular formula C20H36O4Si and a molecular weight of 368.59 g/mol. Its IUPAC name is (2R,3S)-2-(cyclopenten-1-yl)-2-hydroxy-3-[tri(propan-2-yl)silyloxymethyl]pent-4-enoic acid.
| Compound Name | (2R,3S)-2-(cyclopenten-1-yl)-2-hydroxy-3-[tri(propan-2-yl)silyloxymethyl]pent-4-enoic acid |
|---|---|
| PubChem CID | 100953379 |
| Molecular Formula | C20H36O4Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | (2R,3S)-2-(cyclopenten-1-yl)-2-hydroxy-3-[tri(propan-2-yl)silyloxymethyl]pent-4-enoic acid |
| SMILES | C=C[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)[C@](O)(C(=O)O)C1=CCCC1 |
| InChI | InChI=1S/C20H36O4Si/c1-8-17(20(23,19(21)22)18-11-9-10-12-18)13-24-25(14(2)3,15(4)5)16(6)7/h8,11,14-17,23H,1,9-10,12-13H2,2-7H3,(H,21,22)/t17-,20+/m0/s1 |
| InChIKey | CRBCSAGEPXGYCB-FXAWDEMLSA-N |
| XLogP | 4.91 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|