About (2R)-2,5-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide
(2R)-2,5-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide (PubChem CID 100953485) has the molecular formula C11H12N2O3
and a molecular weight of 220.23 g/mol. Its IUPAC name is (2R)-2,5-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide.
Molecular Properties
| Compound Name | (2R)-2,5-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide |
| PubChem CID | 100953485 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | (2R)-2,5-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide |
| SMILES | Cc1cccc2c1NC(=O)[C@@](C)(C(N)=O)O2 |
| InChI | InChI=1S/C11H12N2O3/c1-6-4-3-5-7-8(6)13-10(15)11(2,16-7)9(12)14/h3-5H,1-2H3,(H2,12,14)(H,13,15)/t11-/m1/s1 |
| InChIKey | RUDRPNJHPMSRBL-LLVKDONJSA-N |
| XLogP | 0.57 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2,5-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2,5-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide?
The IUPAC name of (2R)-2,5-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide (CID 100953485) is (2R)-2,5-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide.
What is the SMILES notation for (2R)-2,5-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide?
The canonical SMILES for (2R)-2,5-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide is Cc1cccc2c1NC(=O)[C@@](C)(C(N)=O)O2.
What is the InChIKey of (2R)-2,5-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide?
The InChIKey is RUDRPNJHPMSRBL-LLVKDONJSA-N. The full InChI is InChI=1S/C11H12N2O3/c1-6-4-3-5-7-8(6)13-10(15)11(2,16-7)9(12)14/h3-5H,1-2H3,(H2,12,14)(H,13,15)/t11-/m1/s1.
What are the key properties of (2R)-2,5-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide?
(2R)-2,5-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide has a molecular weight of 220.23 g/mol, XLogP of 0.57, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2,5-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide is sourced from PubChem (CID 100953485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).