C21H16O3 — CID 100953565
(1R,2R,6R,7S)-1,8-diphenyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 100953565) has the molecular formula C21H16O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is (1R,2R,6R,7S)-1,8-diphenyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6R,7S)-1,8-diphenyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 100953565 |
| Molecular Formula | C21H16O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (1R,2R,6R,7S)-1,8-diphenyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1OC(=O)[C@@H]2[C@H]1[C@@H]1C[C@@]2(c2ccccc2)C=C1c1ccccc1 |
| InChI | InChI=1S/C21H16O3/c22-19-17-16-12-21(18(17)20(23)24-19,14-9-5-2-6-10-14)11-15(16)13-7-3-1-4-8-13/h1-11,16-18H,12H2/t16-,17-,18+,21-/m1/s1 |
| InChIKey | PNNQZUVDHWJKDC-DCXXXQMHSA-N |
| XLogP | 3.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|