C22H20N4O3S2 — CID 10095393
1-[5-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]naphthalen-1-yl]-3-phenylthiourea (PubChem CID 10095393) has the molecular formula C22H20N4O3S2 and a molecular weight of 452.56 g/mol. Its IUPAC name is 1-[5-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]naphthalen-1-yl]-3-phenylthiourea.
| Compound Name | 1-[5-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]naphthalen-1-yl]-3-phenylthiourea |
|---|---|
| PubChem CID | 10095393 |
| Molecular Formula | C22H20N4O3S2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 1-[5-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]naphthalen-1-yl]-3-phenylthiourea |
| SMILES | Cc1noc(NS(=O)(=O)c2cccc3c(NC(=S)Nc4ccccc4)cccc23)c1C |
| InChI | InChI=1S/C22H20N4O3S2/c1-14-15(2)25-29-21(14)26-31(27,28)20-13-7-10-17-18(20)11-6-12-19(17)24-22(30)23-16-8-4-3-5-9-16/h3-13,26H,1-2H3,(H2,23,24,30) |
| InChIKey | GSPSAYRFOXTOER-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|