About [(2S,3S,4S)-2-benzyl-4-iodo-1-(9-phenylfluoren-9-yl)pyrrolidin-3-yl] acetate
[(2S,3S,4S)-2-benzyl-4-iodo-1-(9-phenylfluoren-9-yl)pyrrolidin-3-yl] acetate (PubChem CID 100954255) has the molecular formula C32H28INO2
and a molecular weight of 585.49 g/mol. Its IUPAC name is [(2S,3S,4S)-2-benzyl-4-iodo-1-(9-phenylfluoren-9-yl)pyrrolidin-3-yl] acetate.
Molecular Properties
| Compound Name | [(2S,3S,4S)-2-benzyl-4-iodo-1-(9-phenylfluoren-9-yl)pyrrolidin-3-yl] acetate |
| PubChem CID | 100954255 |
| Molecular Formula | C32H28INO2 |
| Molecular Weight | 585.49 g/mol |
| Exact Mass | 585.12 |
| IUPAC Name | [(2S,3S,4S)-2-benzyl-4-iodo-1-(9-phenylfluoren-9-yl)pyrrolidin-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](I)CN(C2(c3ccccc3)c3ccccc3-c3ccccc32)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C32H28INO2/c1-22(35)36-31-29(33)21-34(30(31)20-23-12-4-2-5-13-23)32(24-14-6-3-7-15-24)27-18-10-8-16-25(27)26-17-9-11-19-28(26)32/h2-19,29-31H,20-21H2,1H3/t29-,30-,31+/m0/s1 |
| InChIKey | UZROYGAYIJAOIA-RWSKJCERSA-N |
| XLogP | 6.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 585.49 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(2S,3S,4S)-2-benzyl-4-iodo-1-(9-phenylfluoren-9-yl)pyrrolidin-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S,4S)-2-benzyl-4-iodo-1-(9-phenylfluoren-9-yl)pyrrolidin-3-yl] acetate?
The IUPAC name of [(2S,3S,4S)-2-benzyl-4-iodo-1-(9-phenylfluoren-9-yl)pyrrolidin-3-yl] acetate (CID 100954255) is [(2S,3S,4S)-2-benzyl-4-iodo-1-(9-phenylfluoren-9-yl)pyrrolidin-3-yl] acetate.
What is the SMILES notation for [(2S,3S,4S)-2-benzyl-4-iodo-1-(9-phenylfluoren-9-yl)pyrrolidin-3-yl] acetate?
The canonical SMILES for [(2S,3S,4S)-2-benzyl-4-iodo-1-(9-phenylfluoren-9-yl)pyrrolidin-3-yl] acetate is CC(=O)O[C@@H]1[C@@H](I)CN(C2(c3ccccc3)c3ccccc3-c3ccccc32)[C@H]1Cc1ccccc1.
What is the InChIKey of [(2S,3S,4S)-2-benzyl-4-iodo-1-(9-phenylfluoren-9-yl)pyrrolidin-3-yl] acetate?
The InChIKey is UZROYGAYIJAOIA-RWSKJCERSA-N. The full InChI is InChI=1S/C32H28INO2/c1-22(35)36-31-29(33)21-34(30(31)20-23-12-4-2-5-13-23)32(24-14-6-3-7-15-24)27-18-10-8-16-25(27)26-17-9-11-19-28(26)32/h2-19,29-31H,20-21H2,1H3/t29-,30-,31+/m0/s1.
What are the key properties of [(2S,3S,4S)-2-benzyl-4-iodo-1-(9-phenylfluoren-9-yl)pyrrolidin-3-yl] acetate?
[(2S,3S,4S)-2-benzyl-4-iodo-1-(9-phenylfluoren-9-yl)pyrrolidin-3-yl] acetate has a molecular weight of 585.49 g/mol, XLogP of 6.62, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S,4S)-2-benzyl-4-iodo-1-(9-phenylfluoren-9-yl)pyrrolidin-3-yl] acetate is sourced from PubChem (CID 100954255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).