C21H38N6O5 — CID 10095492
(2S)-2-acetamido-N-[(2S)-1-[[(3S)-6-(diaminomethylideneamino)-1,2-dioxohexan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-methylpentanamide (PubChem CID 10095492) has the molecular formula C21H38N6O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is (2S)-2-acetamido-N-[(2S)-1-[[(3S)-6-(diaminomethylideneamino)-1,2-dioxohexan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-methylpentanamide.
| Compound Name | (2S)-2-acetamido-N-[(2S)-1-[[(3S)-6-(diaminomethylideneamino)-1,2-dioxohexan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 10095492 |
| Molecular Formula | C21H38N6O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | (2S)-2-acetamido-N-[(2S)-1-[[(3S)-6-(diaminomethylideneamino)-1,2-dioxohexan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-methylpentanamide |
| SMILES | CC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)C=O |
| InChI | InChI=1S/C21H38N6O5/c1-12(2)9-16(25-14(5)29)19(31)27-17(10-13(3)4)20(32)26-15(18(30)11-28)7-6-8-24-21(22)23/h11-13,15-17H,6-10H2,1-5H3,(H,25,29)(H,26,32)(H,27,31)(H4,22,23,24)/t15-,16-,17-/m0/s1 |
| InChIKey | SDHUBIMNNXCDCV-ULQDDVLXSA-N |
| XLogP | -0.63 |
| TPSA | 185.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|