C27H30O3Si — CID 100955837
ethyl 3-[(3R,5S)-5-methyl-2,2,5-triphenyloxasilolan-3-yl]propanoate (PubChem CID 100955837) has the molecular formula C27H30O3Si and a molecular weight of 430.62 g/mol. Its IUPAC name is ethyl 3-[(3R,5S)-5-methyl-2,2,5-triphenyloxasilolan-3-yl]propanoate.
| Compound Name | ethyl 3-[(3R,5S)-5-methyl-2,2,5-triphenyloxasilolan-3-yl]propanoate |
|---|---|
| PubChem CID | 100955837 |
| Molecular Formula | C27H30O3Si |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | ethyl 3-[(3R,5S)-5-methyl-2,2,5-triphenyloxasilolan-3-yl]propanoate |
| SMILES | CCOC(=O)CC[C@@H]1C[C@@](C)(c2ccccc2)O[Si]1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30O3Si/c1-3-29-26(28)20-19-25-21-27(2,22-13-7-4-8-14-22)30-31(25,23-15-9-5-10-16-23)24-17-11-6-12-18-24/h4-18,25H,3,19-21H2,1-2H3/t25-,27+/m1/s1 |
| InChIKey | QEHZVCKBANIPHR-VPUSJEBWSA-N |
| XLogP | 4.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|