C14H22O8 — CID 100956118
(2R)-2-[(2S)-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]-2,3-dihydropyran-6-one (PubChem CID 100956118) has the molecular formula C14H22O8 and a molecular weight of 318.32 g/mol. Its IUPAC name is (2R)-2-[(2S)-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(2S)-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 100956118 |
| Molecular Formula | C14H22O8 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (2R)-2-[(2S)-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]-2,3-dihydropyran-6-one |
| SMILES | C[C@@H](C[C@H]1CC=CC(=O)O1)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H22O8/c1-7(5-8-3-2-4-10(16)21-8)20-14-13(19)12(18)11(17)9(6-15)22-14/h2,4,7-9,11-15,17-19H,3,5-6H2,1H3/t7-,8+,9+,11+,12-,13+,14+/m0/s1 |
| InChIKey | PVELSPIMHJCNLK-LRBFLHOCSA-N |
| XLogP | -1.55 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |