C18H24O4 — CID 100956179
(3aS,3bR,5R,9aR,9bS,11aS)-5-hydroxy-9a,11a-dimethyl-2,3,3a,3b,4,5,9,9b,10,11-decahydroindeno[4,5-h]isochromene-1,7-dione (PubChem CID 100956179) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is (3aS,3bR,5R,9aR,9bS,11aS)-5-hydroxy-9a,11a-dimethyl-2,3,3a,3b,4,5,9,9b,10,11-decahydroindeno[4,5-h]isochromene-1,7-dione.
| Compound Name | (3aS,3bR,5R,9aR,9bS,11aS)-5-hydroxy-9a,11a-dimethyl-2,3,3a,3b,4,5,9,9b,10,11-decahydroindeno[4,5-h]isochromene-1,7-dione |
|---|---|
| PubChem CID | 100956179 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (3aS,3bR,5R,9aR,9bS,11aS)-5-hydroxy-9a,11a-dimethyl-2,3,3a,3b,4,5,9,9b,10,11-decahydroindeno[4,5-h]isochromene-1,7-dione |
| SMILES | C[C@]12COC(=O)C=C1[C@H](O)C[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C18H24O4/c1-17-6-5-12-10(11(17)3-4-15(17)20)7-14(19)13-8-16(21)22-9-18(12,13)2/h8,10-12,14,19H,3-7,9H2,1-2H3/t10-,11-,12-,14+,17-,18+/m0/s1 |
| InChIKey | HQVDPNWDDKFRDI-SHRLPMRXSA-N |
| XLogP | 2.25 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |