C12H18O — CID 100957266
(8S,8aR)-8-ethyl-4,5,6,7,8,8a-hexahydro-1H-azulen-2-one (PubChem CID 100957266) has the molecular formula C12H18O and a molecular weight of 178.28 g/mol. Its IUPAC name is (8S,8aR)-8-ethyl-4,5,6,7,8,8a-hexahydro-1H-azulen-2-one.
| Compound Name | (8S,8aR)-8-ethyl-4,5,6,7,8,8a-hexahydro-1H-azulen-2-one |
|---|---|
| PubChem CID | 100957266 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (8S,8aR)-8-ethyl-4,5,6,7,8,8a-hexahydro-1H-azulen-2-one |
| SMILES | CC[C@H]1CCCCC2=CC(=O)C[C@@H]21 |
| InChI | InChI=1S/C12H18O/c1-2-9-5-3-4-6-10-7-11(13)8-12(9)10/h7,9,12H,2-6,8H2,1H3/t9-,12+/m0/s1 |
| InChIKey | CZVCFDXXGZAQIX-JOYOIKCWSA-N |
| XLogP | 3.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |