C12H12N3NaO7S — CID 100957499
sodium (2S,3R,5R)-3-methyl-3-[(Z)-1,2-oxazol-5-ylmethoxyiminomethyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 100957499) has the molecular formula C12H12N3NaO7S and a molecular weight of 365.30 g/mol. Its IUPAC name is sodium (2S,3R,5R)-3-methyl-3-[(Z)-1,2-oxazol-5-ylmethoxyiminomethyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2S,3R,5R)-3-methyl-3-[(Z)-1,2-oxazol-5-ylmethoxyiminomethyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 100957499 |
| Molecular Formula | C12H12N3NaO7S |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | sodium (2S,3R,5R)-3-methyl-3-[(Z)-1,2-oxazol-5-ylmethoxyiminomethyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@]1(/C=N\OCc2ccno2)[C@H](C(=O)[O-])N2C(=O)C[C@H]2S1(=O)=O.[Na+] |
| InChI | InChI=1S/C12H13N3O7S.Na/c1-12(6-14-21-5-7-2-3-13-22-7)10(11(17)18)15-8(16)4-9(15)23(12,19)20;/h2-3,6,9-10H,4-5H2,1H3,(H,17,18);/q;+1/p-1/b14-6-;/t9-,10+,12+;/m1./s1 |
| InChIKey | ONQIWKQQEJDEGH-PNZKIXKSSA-M |
| XLogP | -4.95 |
| TPSA | 142.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | -4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|