C23H29N3O4 — CID 100957507
13-(1,10-phenanthrolin-2-ylmethyl)-1,4,7,10-tetraoxa-13-azacyclopentadecane (PubChem CID 100957507) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is 13-(1,10-phenanthrolin-2-ylmethyl)-1,4,7,10-tetraoxa-13-azacyclopentadecane.
| Compound Name | 13-(1,10-phenanthrolin-2-ylmethyl)-1,4,7,10-tetraoxa-13-azacyclopentadecane |
|---|---|
| PubChem CID | 100957507 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 13-(1,10-phenanthrolin-2-ylmethyl)-1,4,7,10-tetraoxa-13-azacyclopentadecane |
| SMILES | c1cnc2c(c1)ccc1ccc(CN3CCOCCOCCOCCOCC3)nc12 |
| InChI | InChI=1S/C23H29N3O4/c1-2-19-3-4-20-5-6-21(25-23(20)22(19)24-7-1)18-26-8-10-27-12-14-29-16-17-30-15-13-28-11-9-26/h1-7H,8-18H2 |
| InChIKey | ZBHZCLODJQFMLH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 65.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|