C29H32F12NO3P — CID 100957729
ethyl N-(1-diphenylphosphoryl-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorotetradecyl)carbamate (PubChem CID 100957729) has the molecular formula C29H32F12NO3P and a molecular weight of 701.53 g/mol. Its IUPAC name is ethyl N-(1-diphenylphosphoryl-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorotetradecyl)carbamate.
| Compound Name | ethyl N-(1-diphenylphosphoryl-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorotetradecyl)carbamate |
|---|---|
| PubChem CID | 100957729 |
| Molecular Formula | C29H32F12NO3P |
| Molecular Weight | 701.53 g/mol |
| Exact Mass | 701.19 |
| IUPAC Name | ethyl N-(1-diphenylphosphoryl-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorotetradecyl)carbamate |
| SMILES | CCCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(NC(=O)OCC)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H32F12NO3P/c1-3-5-6-7-14-19-24(30,31)26(34,35)28(38,39)29(40,41)27(36,37)25(32,33)22(42-23(43)45-4-2)46(44,20-15-10-8-11-16-20)21-17-12-9-13-18-21/h8-13,15-18,22H,3-7,14,19H2,1-2H3,(H,42,43) |
| InChIKey | HCRBYVLQQWWIDZ-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.53 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|