C18H29O3S- — CID 100958077
6-phenyldodecane-1-sulfonate (PubChem CID 100958077) has the molecular formula C18H29O3S- and a molecular weight of 325.49 g/mol. Its IUPAC name is 6-phenyldodecane-1-sulfonate.
| Compound Name | 6-phenyldodecane-1-sulfonate |
|---|---|
| PubChem CID | 100958077 |
| Molecular Formula | C18H29O3S- |
| Molecular Weight | 325.49 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 6-phenyldodecane-1-sulfonate |
| SMILES | CCCCCCC(CCCCCS(=O)(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C18H30O3S/c1-2-3-4-7-12-17(18-13-8-5-9-14-18)15-10-6-11-16-22(19,20)21/h5,8-9,13-14,17H,2-4,6-7,10-12,15-16H2,1H3,(H,19,20,21)/p-1 |
| InChIKey | XKPVNCVVPSNOED-UHFFFAOYSA-M |
| XLogP | 4.85 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.49 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|