C13H18O4 — CID 100958560
2,2,4,4-tetramethyl-6-propanoylcyclohexane-1,3,5-trione (PubChem CID 100958560) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-6-propanoylcyclohexane-1,3,5-trione.
| Compound Name | 2,2,4,4-tetramethyl-6-propanoylcyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 100958560 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2,2,4,4-tetramethyl-6-propanoylcyclohexane-1,3,5-trione |
| SMILES | CCC(=O)C1C(=O)C(C)(C)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C13H18O4/c1-6-7(14)8-9(15)12(2,3)11(17)13(4,5)10(8)16/h8H,6H2,1-5H3 |
| InChIKey | IZVWNTVILPFEDY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|