C11H16O3 — CID 100958640
(1R,2S,4R,5R)-2-methoxy-1,4,5-trimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 100958640) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (1R,2S,4R,5R)-2-methoxy-1,4,5-trimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1R,2S,4R,5R)-2-methoxy-1,4,5-trimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 100958640 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (1R,2S,4R,5R)-2-methoxy-1,4,5-trimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | CO[C@@H]1C(=O)[C@H](C)[C@@]2(C)C=C[C@@]1(C)O2 |
| InChI | InChI=1S/C11H16O3/c1-7-8(12)9(13-4)11(3)6-5-10(7,2)14-11/h5-7,9H,1-4H3/t7-,9+,10+,11+/m0/s1 |
| InChIKey | NMVRLWVBOFCRGK-AYHFEMFVSA-N |
| XLogP | 1.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|