C12H16S2 — CID 100958713
2-phenyl-1,3-dithiocane (PubChem CID 100958713) has the molecular formula C12H16S2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 2-phenyl-1,3-dithiocane.
| Compound Name | 2-phenyl-1,3-dithiocane |
|---|---|
| PubChem CID | 100958713 |
| Molecular Formula | C12H16S2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2-phenyl-1,3-dithiocane |
| SMILES | c1ccc(C2SCCCCCS2)cc1 |
| InChI | InChI=1S/C12H16S2/c1-3-7-11(8-4-1)12-13-9-5-2-6-10-14-12/h1,3-4,7-8,12H,2,5-6,9-10H2 |
| InChIKey | KOCNUDSDWUNCPI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |