About (3E)-8,8-dimethyl-4-phenyl-6-phenylsulfanylcyclooct-3-en-1-one
(3E)-8,8-dimethyl-4-phenyl-6-phenylsulfanylcyclooct-3-en-1-one (PubChem CID 100958769) has the molecular formula C22H24OS
and a molecular weight of 336.50 g/mol. Its IUPAC name is (3E)-8,8-dimethyl-4-phenyl-6-phenylsulfanylcyclooct-3-en-1-one.
Molecular Properties
| Compound Name | (3E)-8,8-dimethyl-4-phenyl-6-phenylsulfanylcyclooct-3-en-1-one |
| PubChem CID | 100958769 |
| Molecular Formula | C22H24OS |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (3E)-8,8-dimethyl-4-phenyl-6-phenylsulfanylcyclooct-3-en-1-one |
| SMILES | CC1(C)CC(Sc2ccccc2)C/C(c2ccccc2)=C\CC1=O |
| InChI | InChI=1S/C22H24OS/c1-22(2)16-20(24-19-11-7-4-8-12-19)15-18(13-14-21(22)23)17-9-5-3-6-10-17/h3-13,20H,14-16H2,1-2H3/b18-13+ |
| InChIKey | CSARPEQXOAJSEK-QGOAFFKASA-N |
| XLogP | 6.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3E)-8,8-dimethyl-4-phenyl-6-phenylsulfanylcyclooct-3-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-8,8-dimethyl-4-phenyl-6-phenylsulfanylcyclooct-3-en-1-one?
The IUPAC name of (3E)-8,8-dimethyl-4-phenyl-6-phenylsulfanylcyclooct-3-en-1-one (CID 100958769) is (3E)-8,8-dimethyl-4-phenyl-6-phenylsulfanylcyclooct-3-en-1-one.
What is the SMILES notation for (3E)-8,8-dimethyl-4-phenyl-6-phenylsulfanylcyclooct-3-en-1-one?
The canonical SMILES for (3E)-8,8-dimethyl-4-phenyl-6-phenylsulfanylcyclooct-3-en-1-one is CC1(C)CC(Sc2ccccc2)C/C(c2ccccc2)=C\CC1=O.
What is the InChIKey of (3E)-8,8-dimethyl-4-phenyl-6-phenylsulfanylcyclooct-3-en-1-one?
The InChIKey is CSARPEQXOAJSEK-QGOAFFKASA-N. The full InChI is InChI=1S/C22H24OS/c1-22(2)16-20(24-19-11-7-4-8-12-19)15-18(13-14-21(22)23)17-9-5-3-6-10-17/h3-13,20H,14-16H2,1-2H3/b18-13+.
What are the key properties of (3E)-8,8-dimethyl-4-phenyl-6-phenylsulfanylcyclooct-3-en-1-one?
(3E)-8,8-dimethyl-4-phenyl-6-phenylsulfanylcyclooct-3-en-1-one has a molecular weight of 336.50 g/mol, XLogP of 6.01, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-8,8-dimethyl-4-phenyl-6-phenylsulfanylcyclooct-3-en-1-one is sourced from PubChem (CID 100958769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).