C25H20F2N4OS — CID 10095879
6-[[2-[4-(6,8-difluoroquinolin-4-yl)phenyl]ethylamino]methyl]-4H-pyrido[3,2-b][1,4]thiazin-3-one (PubChem CID 10095879) has the molecular formula C25H20F2N4OS and a molecular weight of 462.53 g/mol. Its IUPAC name is 6-[[2-[4-(6,8-difluoroquinolin-4-yl)phenyl]ethylamino]methyl]-4H-pyrido[3,2-b][1,4]thiazin-3-one.
| Compound Name | 6-[[2-[4-(6,8-difluoroquinolin-4-yl)phenyl]ethylamino]methyl]-4H-pyrido[3,2-b][1,4]thiazin-3-one |
|---|---|
| PubChem CID | 10095879 |
| Molecular Formula | C25H20F2N4OS |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 6-[[2-[4-(6,8-difluoroquinolin-4-yl)phenyl]ethylamino]methyl]-4H-pyrido[3,2-b][1,4]thiazin-3-one |
| SMILES | O=C1CSc2ccc(CNCCc3ccc(-c4ccnc5c(F)cc(F)cc45)cc3)nc2N1 |
| InChI | InChI=1S/C25H20F2N4OS/c26-17-11-20-19(8-10-29-24(20)21(27)12-17)16-3-1-15(2-4-16)7-9-28-13-18-5-6-22-25(30-18)31-23(32)14-33-22/h1-6,8,10-12,28H,7,9,13-14H2,(H,30,31,32) |
| InChIKey | SPAYKZKGGUUCQE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|